C15H19BrN2O2 — CID 98750637
N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-bromobenzamide (PubChem CID 98750637) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-bromobenzamide.
| Compound Name | N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-bromobenzamide |
|---|---|
| PubChem CID | 98750637 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-bromobenzamide |
| SMILES | O=C(NC[C@@H]1CN2CCC[C@H]2CO1)c1ccccc1Br |
| InChI | InChI=1S/C15H19BrN2O2/c16-14-6-2-1-5-13(14)15(19)17-8-12-9-18-7-3-4-11(18)10-20-12/h1-2,5-6,11-12H,3-4,7-10H2,(H,17,19)/t11-,12+/m0/s1 |
| InChIKey | LFROATLSSBAXCW-NWDGAFQWSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |