C16H19F3N2O2 — CID 94823026
N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(trifluoromethyl)benzamide (PubChem CID 94823026) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 94823026 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC[C@@H]1CN2CCC[C@@H]2CO1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O2/c17-16(18,19)14-6-2-1-5-13(14)15(22)20-8-12-9-21-7-3-4-11(21)10-23-12/h1-2,5-6,11-12H,3-4,7-10H2,(H,20,22)/t11-,12-/m1/s1 |
| InChIKey | ZIUIBLSKAKLRRD-VXGBXAGGSA-N |
| XLogP | 2.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |