C15H18FIN2O2 — CID 60616328
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-fluoro-2-iodobenzamide (PubChem CID 60616328) has the molecular formula C15H18FIN2O2 and a molecular weight of 404.22 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-fluoro-2-iodobenzamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 60616328 |
| Molecular Formula | C15H18FIN2O2 |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-5-fluoro-2-iodobenzamide |
| SMILES | O=C(NCC1CN2CCCC2CO1)c1cc(F)ccc1I |
| InChI | InChI=1S/C15H18FIN2O2/c16-10-3-4-14(17)13(6-10)15(20)18-7-12-8-19-5-1-2-11(19)9-21-12/h3-4,6,11-12H,1-2,5,7-9H2,(H,18,20) |
| InChIKey | HRZPDTAFHHUTIK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|