C16H19N3O2 — CID 94810921
N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-cyanobenzamide (PubChem CID 94810921) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-cyanobenzamide.
| Compound Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 94810921 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-cyanobenzamide |
| SMILES | N#Cc1cccc(C(=O)NC[C@@H]2CN3CCC[C@@H]3CO2)c1 |
| InChI | InChI=1S/C16H19N3O2/c17-8-12-3-1-4-13(7-12)16(20)18-9-15-10-19-6-2-5-14(19)11-21-15/h1,3-4,7,14-15H,2,5-6,9-11H2,(H,18,20)/t14-,15-/m1/s1 |
| InChIKey | OLFOHOQAMVDQIC-HUUCEWRRSA-N |
| XLogP | 1.15 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |