C16H20N4O2 — CID 95593465
1-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(3-cyanophenyl)urea (PubChem CID 95593465) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(3-cyanophenyl)urea.
| Compound Name | 1-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(3-cyanophenyl)urea |
|---|---|
| PubChem CID | 95593465 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(3-cyanophenyl)urea |
| SMILES | N#Cc1cccc(NC(=O)NC[C@H]2CN3CCC[C@@H]3CO2)c1 |
| InChI | InChI=1S/C16H20N4O2/c17-8-12-3-1-4-13(7-12)19-16(21)18-9-15-10-20-6-2-5-14(20)11-22-15/h1,3-4,7,14-15H,2,5-6,9-11H2,(H2,18,19,21)/t14-,15+/m1/s1 |
| InChIKey | CZKCOAGVEIEQOJ-CABCVRRESA-N |
| XLogP | 1.54 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |