C21H24N2O3 — CID 49097653
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-phenoxybenzamide (PubChem CID 49097653) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-phenoxybenzamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-phenoxybenzamide |
|---|---|
| PubChem CID | 49097653 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-3-phenoxybenzamide |
| SMILES | O=C(NCC1CN2CCCC2CO1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C21H24N2O3/c24-21(22-13-20-14-23-11-5-7-17(23)15-25-20)16-6-4-10-19(12-16)26-18-8-2-1-3-9-18/h1-4,6,8-10,12,17,20H,5,7,11,13-15H2,(H,22,24) |
| InChIKey | NPUIOTHJAFKPOF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |