C19H28N2O3 — CID 98751304
N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(2-methylpropoxy)benzamide (PubChem CID 98751304) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(2-methylpropoxy)benzamide.
| Compound Name | N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 98751304 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1cccc(C(=O)NC[C@H]2CN3CCC[C@H]3CO2)c1 |
| InChI | InChI=1S/C19H28N2O3/c1-14(2)12-23-17-7-3-5-15(9-17)19(22)20-10-18-11-21-8-4-6-16(21)13-24-18/h3,5,7,9,14,16,18H,4,6,8,10-13H2,1-2H3,(H,20,22)/t16-,18-/m0/s1 |
| InChIKey | PUSKNESHXAJBDC-WMZOPIPTSA-N |
| XLogP | 2.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |