C18H26N2O4 — CID 94890643
N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-ethoxy-3-methoxybenzamide (PubChem CID 94890643) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-ethoxy-3-methoxybenzamide.
| Compound Name | N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-ethoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 94890643 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[[(3R,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-ethoxy-3-methoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC[C@@H]2CN3CCC[C@H]3CO2)cc1OC |
| InChI | InChI=1S/C18H26N2O4/c1-3-23-16-7-6-13(9-17(16)22-2)18(21)19-10-15-11-20-8-4-5-14(20)12-24-15/h6-7,9,14-15H,3-5,8,10-12H2,1-2H3,(H,19,21)/t14-,15+/m0/s1 |
| InChIKey | XELZWHRGONPAAL-LSDHHAIUSA-N |
| XLogP | 1.69 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |