C18H23N3O4 — CID 98756181
N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(4-cyano-2-methoxyphenoxy)acetamide (PubChem CID 98756181) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(4-cyano-2-methoxyphenoxy)acetamide.
| Compound Name | N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(4-cyano-2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 98756181 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-2-(4-cyano-2-methoxyphenoxy)acetamide |
| SMILES | COc1cc(C#N)ccc1OCC(=O)NC[C@H]1CN2CCC[C@H]2CO1 |
| InChI | InChI=1S/C18H23N3O4/c1-23-17-7-13(8-19)4-5-16(17)25-12-18(22)20-9-15-10-21-6-2-3-14(21)11-24-15/h4-5,7,14-15H,2-3,6,9-12H2,1H3,(H,20,22)/t14-,15-/m0/s1 |
| InChIKey | IZTGULYCSNXOAW-GJZGRUSLSA-N |
| XLogP | 0.93 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |