C15H19FN2O3 — CID 104929726
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-fluoro-4-hydroxybenzamide (PubChem CID 104929726) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-fluoro-4-hydroxybenzamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-fluoro-4-hydroxybenzamide |
|---|---|
| PubChem CID | 104929726 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-fluoro-4-hydroxybenzamide |
| SMILES | O=C(NCC1CN2CCCC2CO1)c1ccc(O)cc1F |
| InChI | InChI=1S/C15H19FN2O3/c16-14-6-11(19)3-4-13(14)15(20)17-7-12-8-18-5-1-2-10(18)9-21-12/h3-4,6,10,12,19H,1-2,5,7-9H2,(H,17,20) |
| InChIKey | JRVKVYDFRLFTSY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |