C14H18FN3O2 — CID 115497987
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-fluoropyridine-2-carboxamide (PubChem CID 115497987) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-fluoropyridine-2-carboxamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 115497987 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-fluoropyridine-2-carboxamide |
| SMILES | O=C(NCC1CN2CCCC2CO1)c1cccc(F)n1 |
| InChI | InChI=1S/C14H18FN3O2/c15-13-5-1-4-12(17-13)14(19)16-7-11-8-18-6-2-3-10(18)9-20-11/h1,4-5,10-11H,2-3,6-9H2,(H,16,19) |
| InChIKey | HPIDSLSWYRIBBI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|