C13H19N5O2 — CID 79072183
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-aminopyridazine-3-carboxamide (PubChem CID 79072183) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-aminopyridazine-3-carboxamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-aminopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 79072183 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-aminopyridazine-3-carboxamide |
| SMILES | Nc1ccc(C(=O)NCC2CN3CCCC3CO2)nn1 |
| InChI | InChI=1S/C13H19N5O2/c14-12-4-3-11(16-17-12)13(19)15-6-10-7-18-5-1-2-9(18)8-20-10/h3-4,9-10H,1-2,5-8H2,(H2,14,17)(H,15,19) |
| InChIKey | CSUKBCDKDUOXQL-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |