C13H21N5O2 — CID 79079132
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-1-methylpyrazole-5-carboxamide (PubChem CID 79079132) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-1-methylpyrazole-5-carboxamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 79079132 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1ncc(N)c1C(=O)NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C13H21N5O2/c1-17-12(11(14)6-16-17)13(19)15-5-10-7-18-4-2-3-9(18)8-20-10/h6,9-10H,2-5,7-8,14H2,1H3,(H,15,19) |
| InChIKey | YDWQNCXZXJFEIA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |