C13H21N5O2S — CID 116670971
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-2-(methylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116670971) has the molecular formula C13H21N5O2S and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-2-(methylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-2-(methylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116670971 |
| Molecular Formula | C13H21N5O2S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-2-(methylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CNc1nc(N)c(C(=O)NCC2CN3CCCC3CO2)s1 |
| InChI | InChI=1S/C13H21N5O2S/c1-15-13-17-11(14)10(21-13)12(19)16-5-9-6-18-4-2-3-8(18)7-20-9/h8-9H,2-7,14H2,1H3,(H,15,17)(H,16,19) |
| InChIKey | PLYUAOJJQDXENB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |