C14H23N5O2 — CID 79079438
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-1-ethylpyrazole-5-carboxamide (PubChem CID 79079438) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-1-ethylpyrazole-5-carboxamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 79079438 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-amino-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(N)c1C(=O)NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H23N5O2/c1-2-19-13(12(15)7-17-19)14(20)16-6-11-8-18-5-3-4-10(18)9-21-11/h7,10-11H,2-6,8-9,15H2,1H3,(H,16,20) |
| InChIKey | SFVNFPQPCWOWBV-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |