C16H19F3N2O2S — CID 52532989
N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 52532989) has the molecular formula C16H19F3N2O2S and a molecular weight of 360.40 g/mol. Its IUPAC name is N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 52532989 |
| Molecular Formula | C16H19F3N2O2S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-[[(3R,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | O=C(NC[C@@H]1CN2CCC[C@@H]2CO1)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N2O2S/c17-16(18,19)24-14-5-3-11(4-6-14)15(22)20-8-13-9-21-7-1-2-12(21)10-23-13/h3-6,12-13H,1-2,7-10H2,(H,20,22)/t12-,13-/m1/s1 |
| InChIKey | SUZZUOMXVZVGER-CHWSQXEVSA-N |
| XLogP | 2.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |