C18H26N2O2 — CID 94824932
N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-propan-2-ylbenzamide (PubChem CID 94824932) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 94824932 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)NC[C@H]2CN3CCC[C@@H]3CO2)cc1 |
| InChI | InChI=1S/C18H26N2O2/c1-13(2)14-5-7-15(8-6-14)18(21)19-10-17-11-20-9-3-4-16(20)12-22-17/h5-8,13,16-17H,3-4,9-12H2,1-2H3,(H,19,21)/t16-,17+/m1/s1 |
| InChIKey | KAOWURKSHPHOFQ-SJORKVTESA-N |
| XLogP | 2.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |