C19H27N3O3 — CID 98750732
N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-morpholin-4-ylbenzamide (PubChem CID 98750732) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-morpholin-4-ylbenzamide.
| Compound Name | N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 98750732 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-morpholin-4-ylbenzamide |
| SMILES | O=C(NC[C@H]1CN2CCC[C@H]2CO1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H27N3O3/c23-19(20-12-18-13-22-7-1-2-17(22)14-25-18)15-3-5-16(6-4-15)21-8-10-24-11-9-21/h3-6,17-18H,1-2,7-14H2,(H,20,23)/t17-,18-/m0/s1 |
| InChIKey | UKVRPECLPXVQAW-ROUUACIJSA-N |
| XLogP | 1.12 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |