C19H23N3O2 — CID 98750642
N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-pyrrol-1-ylbenzamide (PubChem CID 98750642) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 98750642 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(NC[C@H]1CN2CCC[C@H]2CO1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C19H23N3O2/c23-19(15-5-7-16(8-6-15)21-9-1-2-10-21)20-12-18-13-22-11-3-4-17(22)14-24-18/h1-2,5-10,17-18H,3-4,11-14H2,(H,20,23)/t17-,18-/m0/s1 |
| InChIKey | WACMJBYLGJNBBD-ROUUACIJSA-N |
| XLogP | 2.07 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |