C19H28N4O2 — CID 97186160
N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide (PubChem CID 97186160) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide.
| Compound Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
|---|---|
| PubChem CID | 97186160 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-methyl-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
| SMILES | CN1CCN(C(=O)NC[C@H]2CN3CCC[C@@H]3CO2)Cc2ccccc21 |
| InChI | InChI=1S/C19H28N4O2/c1-21-9-10-23(12-15-5-2-3-7-18(15)21)19(24)20-11-17-13-22-8-4-6-16(22)14-25-17/h2-3,5,7,16-17H,4,6,8-14H2,1H3,(H,20,24)/t16-,17+/m1/s1 |
| InChIKey | HMQZKQRALUBFKJ-SJORKVTESA-N |
| XLogP | 1.51 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |