C18H23N3O2 — CID 94817809
N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-methylindole-2-carboxamide (PubChem CID 94817809) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 94817809 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[[(3S,8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)NC[C@H]2CN3CCC[C@@H]3CO2)cc2ccccc21 |
| InChI | InChI=1S/C18H23N3O2/c1-20-16-7-3-2-5-13(16)9-17(20)18(22)19-10-15-11-21-8-4-6-14(21)12-23-15/h2-3,5,7,9,14-15H,4,6,8,10-12H2,1H3,(H,19,22)/t14-,15+/m1/s1 |
| InChIKey | QRPNUWTXIFGSDM-CABCVRRESA-N |
| XLogP | 1.77 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |