C16H22F2N2O — CID 103924783
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,3-difluorophenyl)ethanamine (PubChem CID 103924783) has the molecular formula C16H22F2N2O and a molecular weight of 296.36 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,3-difluorophenyl)ethanamine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,3-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 103924783 |
| Molecular Formula | C16H22F2N2O |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,3-difluorophenyl)ethanamine |
| SMILES | CC(NCC1CN2CCCC2CO1)c1cccc(F)c1F |
| InChI | InChI=1S/C16H22F2N2O/c1-11(14-5-2-6-15(17)16(14)18)19-8-13-9-20-7-3-4-12(20)10-21-13/h2,5-6,11-13,19H,3-4,7-10H2,1H3 |
| InChIKey | CPOHXLXRTNJCQS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |