C14H20Cl2N2OS — CID 103781550
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,5-dichlorothiophen-3-yl)ethanamine (PubChem CID 103781550) has the molecular formula C14H20Cl2N2OS and a molecular weight of 335.30 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,5-dichlorothiophen-3-yl)ethanamine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,5-dichlorothiophen-3-yl)ethanamine |
|---|---|
| PubChem CID | 103781550 |
| Molecular Formula | C14H20Cl2N2OS |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,5-dichlorothiophen-3-yl)ethanamine |
| SMILES | CC(NCC1CN2CCCC2CO1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H20Cl2N2OS/c1-9(12-5-13(15)20-14(12)16)17-6-11-7-18-4-2-3-10(18)8-19-11/h5,9-11,17H,2-4,6-8H2,1H3 |
| InChIKey | RAOHKAGMXUJGFT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |