C14H15BrN2O3 — CID 107915268
5-[3-(2-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]pentanoic acid (PubChem CID 107915268) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 5-[3-(2-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]pentanoic acid.
| Compound Name | 5-[3-(2-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 107915268 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5-[3-(2-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]pentanoic acid |
| SMILES | Cc1ccc(-c2noc(CCCCC(=O)O)n2)c(Br)c1 |
| InChI | InChI=1S/C14H15BrN2O3/c1-9-6-7-10(11(15)8-9)14-16-12(20-17-14)4-2-3-5-13(18)19/h6-8H,2-5H2,1H3,(H,18,19) |
| InChIKey | XQNVPNXINGOAHO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|