C14H13BrN2O3 — CID 107915760
3-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]oxan-4-one (PubChem CID 107915760) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is 3-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]oxan-4-one.
| Compound Name | 3-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]oxan-4-one |
|---|---|
| PubChem CID | 107915760 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3-[3-(3-bromo-4-methylphenyl)-1,2,4-oxadiazol-5-yl]oxan-4-one |
| SMILES | Cc1ccc(-c2noc(C3COCCC3=O)n2)cc1Br |
| InChI | InChI=1S/C14H13BrN2O3/c1-8-2-3-9(6-11(8)15)13-16-14(20-17-13)10-7-19-5-4-12(10)18/h2-3,6,10H,4-5,7H2,1H3 |
| InChIKey | RGUBHUOHFHBOMI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |