C13H15N3O2 — CID 178051547
2-methyl-5-[5-[(3S)-oxolan-3-yl]-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 178051547) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-methyl-5-[5-[(3S)-oxolan-3-yl]-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 2-methyl-5-[5-[(3S)-oxolan-3-yl]-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 178051547 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-methyl-5-[5-[(3S)-oxolan-3-yl]-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Cc1ccc(-c2noc([C@H]3CCOC3)n2)cc1N |
| InChI | InChI=1S/C13H15N3O2/c1-8-2-3-9(6-11(8)14)12-15-13(18-16-12)10-4-5-17-7-10/h2-3,6,10H,4-5,7,14H2,1H3/t10-/m0/s1 |
| InChIKey | SRTVEIDORWFVBH-JTQLQIEISA-N |
| XLogP | 2.13 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|