C14H6Br2N2OS — CID 107916704
3-(4,5-dibromothiophene-2-carbonyl)-1H-indole-6-carbonitrile (PubChem CID 107916704) has the molecular formula C14H6Br2N2OS and a molecular weight of 410.09 g/mol. Its IUPAC name is 3-(4,5-dibromothiophene-2-carbonyl)-1H-indole-6-carbonitrile.
| Compound Name | 3-(4,5-dibromothiophene-2-carbonyl)-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 107916704 |
| Molecular Formula | C14H6Br2N2OS |
| Molecular Weight | 410.09 g/mol |
| Exact Mass | 407.86 |
| IUPAC Name | 3-(4,5-dibromothiophene-2-carbonyl)-1H-indole-6-carbonitrile |
| SMILES | N#Cc1ccc2c(C(=O)c3cc(Br)c(Br)s3)c[nH]c2c1 |
| InChI | InChI=1S/C14H6Br2N2OS/c15-10-4-12(20-14(10)16)13(19)9-6-18-11-3-7(5-17)1-2-8(9)11/h1-4,6,18H |
| InChIKey | AWAVZUUNMAHEOO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.09 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |