C12H12Cl2N2S — CID 107918051
[2-(3,5-dichlorophenyl)-4-ethyl-1,3-thiazol-5-yl]methanamine (PubChem CID 107918051) has the molecular formula C12H12Cl2N2S and a molecular weight of 287.22 g/mol. Its IUPAC name is [2-(3,5-dichlorophenyl)-4-ethyl-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-(3,5-dichlorophenyl)-4-ethyl-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 107918051 |
| Molecular Formula | C12H12Cl2N2S |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | [2-(3,5-dichlorophenyl)-4-ethyl-1,3-thiazol-5-yl]methanamine |
| SMILES | CCc1nc(-c2cc(Cl)cc(Cl)c2)sc1CN |
| InChI | InChI=1S/C12H12Cl2N2S/c1-2-10-11(6-15)17-12(16-10)7-3-8(13)5-9(14)4-7/h3-5H,2,6,15H2,1H3 |
| InChIKey | BPPKCFZQDFIWSP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |