C13H10N2O4 — CID 107918751
2-[2-(4-cyano-1H-indol-3-yl)-2-oxoethoxy]acetic acid (PubChem CID 107918751) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is 2-[2-(4-cyano-1H-indol-3-yl)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(4-cyano-1H-indol-3-yl)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 107918751 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[2-(4-cyano-1H-indol-3-yl)-2-oxoethoxy]acetic acid |
| SMILES | N#Cc1cccc2[nH]cc(C(=O)COCC(=O)O)c12 |
| InChI | InChI=1S/C13H10N2O4/c14-4-8-2-1-3-10-13(8)9(5-15-10)11(16)6-19-7-12(17)18/h1-3,5,15H,6-7H2,(H,17,18) |
| InChIKey | OBGHXBCINQIGRH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |