About CID 10791906
CID 10791906 (PubChem CID 10791906) has the molecular formula C23H42NO2SSn
and a molecular weight of 515.37 g/mol.
Molecular Properties
| Compound Name | CID 10791906 |
| PubChem CID | 10791906 |
| Molecular Formula | C23H42NO2SSn |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | — |
| SMILES | C/C(=N\C(C(=O)O)C(C)C)c1cccs1.CCCC[Sn](CCCC)CCCC |
| InChI | InChI=1S/C11H15NO2S.3C4H9.Sn/c1-7(2)10(11(13)14)12-8(3)9-5-4-6-15-9;3*1-3-4-2;/h4-7,10H,1-3H3,(H,13,14);3*1,3-4H2,2H3;/b12-8+;;;; |
| InChIKey | HUDLSWGAAYCXIT-AMBMTFPGSA-N |
| XLogP | 7.55 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 10791906 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10791906?
The IUPAC name of CID 10791906 (CID 10791906) is not available.
What is the SMILES notation for CID 10791906?
The canonical SMILES for CID 10791906 is C/C(=N\C(C(=O)O)C(C)C)c1cccs1.CCCC[Sn](CCCC)CCCC.
What is the InChIKey of CID 10791906?
The InChIKey is HUDLSWGAAYCXIT-AMBMTFPGSA-N. The full InChI is InChI=1S/C11H15NO2S.3C4H9.Sn/c1-7(2)10(11(13)14)12-8(3)9-5-4-6-15-9;3*1-3-4-2;/h4-7,10H,1-3H3,(H,13,14);3*1,3-4H2,2H3;/b12-8+;;;;.
What are the key properties of CID 10791906?
CID 10791906 has a molecular weight of 515.37 g/mol, XLogP of 7.55, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10791906 is sourced from PubChem (CID 10791906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).