C16H8F2N2O — CID 107919907
3-(2,3-difluorobenzoyl)-1H-indole-5-carbonitrile (PubChem CID 107919907) has the molecular formula C16H8F2N2O and a molecular weight of 282.25 g/mol. Its IUPAC name is 3-(2,3-difluorobenzoyl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(2,3-difluorobenzoyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 107919907 |
| Molecular Formula | C16H8F2N2O |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 3-(2,3-difluorobenzoyl)-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(C(=O)c3cccc(F)c3F)c2c1 |
| InChI | InChI=1S/C16H8F2N2O/c17-13-3-1-2-10(15(13)18)16(21)12-8-20-14-5-4-9(7-19)6-11(12)14/h1-6,8,20H |
| InChIKey | PAIKWFWLQGKTFI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |