C15H9F2NO — CID 62648503
(2,3-difluorophenyl)-(1H-indol-3-yl)methanone (PubChem CID 62648503) has the molecular formula C15H9F2NO and a molecular weight of 257.24 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(1H-indol-3-yl)methanone.
| Compound Name | (2,3-difluorophenyl)-(1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 62648503 |
| Molecular Formula | C15H9F2NO |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (2,3-difluorophenyl)-(1H-indol-3-yl)methanone |
| SMILES | O=C(c1cccc(F)c1F)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H9F2NO/c16-12-6-3-5-10(14(12)17)15(19)11-8-18-13-7-2-1-4-9(11)13/h1-8,18H |
| InChIKey | XAQOHOPQQVFEJZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |