C16H15N3S — CID 107920424
1-[(2-propyl-1,3-thiazol-4-yl)methyl]indole-5-carbonitrile (PubChem CID 107920424) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-[(2-propyl-1,3-thiazol-4-yl)methyl]indole-5-carbonitrile.
| Compound Name | 1-[(2-propyl-1,3-thiazol-4-yl)methyl]indole-5-carbonitrile |
|---|---|
| PubChem CID | 107920424 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-[(2-propyl-1,3-thiazol-4-yl)methyl]indole-5-carbonitrile |
| SMILES | CCCc1nc(Cn2ccc3cc(C#N)ccc32)cs1 |
| InChI | InChI=1S/C16H15N3S/c1-2-3-16-18-14(11-20-16)10-19-7-6-13-8-12(9-17)4-5-15(13)19/h4-8,11H,2-3,10H2,1H3 |
| InChIKey | LNEWUYZZKLMWJA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |