C16H12F2N2S — CID 107920707
1-[(2,3-difluorophenyl)methyl]indole-5-carbothioamide (PubChem CID 107920707) has the molecular formula C16H12F2N2S and a molecular weight of 302.35 g/mol. Its IUPAC name is 1-[(2,3-difluorophenyl)methyl]indole-5-carbothioamide.
| Compound Name | 1-[(2,3-difluorophenyl)methyl]indole-5-carbothioamide |
|---|---|
| PubChem CID | 107920707 |
| Molecular Formula | C16H12F2N2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 1-[(2,3-difluorophenyl)methyl]indole-5-carbothioamide |
| SMILES | NC(=S)c1ccc2c(ccn2Cc2cccc(F)c2F)c1 |
| InChI | InChI=1S/C16H12F2N2S/c17-13-3-1-2-12(15(13)18)9-20-7-6-10-8-11(16(19)21)4-5-14(10)20/h1-8H,9H2,(H2,19,21) |
| InChIKey | NMEPINLMNINYAC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|