C12H10F2N2S — CID 114653749
1-[(2,3-difluorophenyl)methyl]pyrrole-2-carbothioamide (PubChem CID 114653749) has the molecular formula C12H10F2N2S and a molecular weight of 252.29 g/mol. Its IUPAC name is 1-[(2,3-difluorophenyl)methyl]pyrrole-2-carbothioamide.
| Compound Name | 1-[(2,3-difluorophenyl)methyl]pyrrole-2-carbothioamide |
|---|---|
| PubChem CID | 114653749 |
| Molecular Formula | C12H10F2N2S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-[(2,3-difluorophenyl)methyl]pyrrole-2-carbothioamide |
| SMILES | NC(=S)c1cccn1Cc1cccc(F)c1F |
| InChI | InChI=1S/C12H10F2N2S/c13-9-4-1-3-8(11(9)14)7-16-6-2-5-10(16)12(15)17/h1-6H,7H2,(H2,15,17) |
| InChIKey | LEZCPPDITAYVFH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|