C10H10N2S2 — CID 114653630
1-(thiophen-2-ylmethyl)pyrrole-2-carbothioamide (PubChem CID 114653630) has the molecular formula C10H10N2S2 and a molecular weight of 222.34 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)pyrrole-2-carbothioamide.
| Compound Name | 1-(thiophen-2-ylmethyl)pyrrole-2-carbothioamide |
|---|---|
| PubChem CID | 114653630 |
| Molecular Formula | C10H10N2S2 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)pyrrole-2-carbothioamide |
| SMILES | NC(=S)c1cccn1Cc1cccs1 |
| InChI | InChI=1S/C10H10N2S2/c11-10(13)9-4-1-5-12(9)7-8-3-2-6-14-8/h1-6H,7H2,(H2,11,13) |
| InChIKey | PWCQYHTVLLCIMC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|