C10H14N2O — CID 107924239
[2-(2,2-dimethylcyclopropyl)pyrimidin-5-yl]methanol (PubChem CID 107924239) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is [2-(2,2-dimethylcyclopropyl)pyrimidin-5-yl]methanol.
| Compound Name | [2-(2,2-dimethylcyclopropyl)pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 107924239 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | [2-(2,2-dimethylcyclopropyl)pyrimidin-5-yl]methanol |
| SMILES | CC1(C)CC1c1ncc(CO)cn1 |
| InChI | InChI=1S/C10H14N2O/c1-10(2)3-8(10)9-11-4-7(6-13)5-12-9/h4-5,8,13H,3,6H2,1-2H3 |
| InChIKey | BBIAZVRKUKQQQS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |