C15H9BrFNS — CID 107924775
2-(2-bromo-5-fluorophenyl)-4-phenyl-1,3-thiazole (PubChem CID 107924775) has the molecular formula C15H9BrFNS and a molecular weight of 334.21 g/mol. Its IUPAC name is 2-(2-bromo-5-fluorophenyl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-(2-bromo-5-fluorophenyl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 107924775 |
| Molecular Formula | C15H9BrFNS |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-(2-bromo-5-fluorophenyl)-4-phenyl-1,3-thiazole |
| SMILES | Fc1ccc(Br)c(-c2nc(-c3ccccc3)cs2)c1 |
| InChI | InChI=1S/C15H9BrFNS/c16-13-7-6-11(17)8-12(13)15-18-14(9-19-15)10-4-2-1-3-5-10/h1-9H |
| InChIKey | VXZLTZTWBKSPRJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |