C31H45NO6Si — CID 10792880
(4R,5S)-3-[(2R,3S,4S)-5-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-3-triethylsilyloxypentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 10792880) has the molecular formula C31H45NO6Si and a molecular weight of 555.79 g/mol. Its IUPAC name is (4R,5S)-3-[(2R,3S,4S)-5-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-3-triethylsilyloxypentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2R,3S,4S)-5-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-3-triethylsilyloxypentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10792880 |
| Molecular Formula | C31H45NO6Si |
| Molecular Weight | 555.79 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | (4R,5S)-3-[(2R,3S,4S)-5-[(4-methoxyphenyl)methoxy]-2,4-dimethyl-3-triethylsilyloxypentanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@@H](C)COCc1ccc(OC)cc1)[C@@H](C)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C31H45NO6Si/c1-8-39(9-2,10-3)38-28(22(4)20-36-21-25-16-18-27(35-7)19-17-25)23(5)30(33)32-24(6)29(37-31(32)34)26-14-12-11-13-15-26/h11-19,22-24,28-29H,8-10,20-21H2,1-7H3/t22-,23+,24+,28-,29+/m0/s1 |
| InChIKey | OSKFYAYOTRICHA-CPMLRDBWSA-N |
| XLogP | 6.98 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.79 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|