C15H22N2OS — CID 107929208
2-[(2,2-dimethyloxan-4-yl)amino]-5-methylbenzenecarbothioamide (PubChem CID 107929208) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 2-[(2,2-dimethyloxan-4-yl)amino]-5-methylbenzenecarbothioamide.
| Compound Name | 2-[(2,2-dimethyloxan-4-yl)amino]-5-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107929208 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[(2,2-dimethyloxan-4-yl)amino]-5-methylbenzenecarbothioamide |
| SMILES | Cc1ccc(NC2CCOC(C)(C)C2)c(C(N)=S)c1 |
| InChI | InChI=1S/C15H22N2OS/c1-10-4-5-13(12(8-10)14(16)19)17-11-6-7-18-15(2,3)9-11/h4-5,8,11,17H,6-7,9H2,1-3H3,(H2,16,19) |
| InChIKey | PCIJJBMTKHBBTF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|