C11H11N5 — CID 107931259
5-methyl-2-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile (PubChem CID 107931259) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is 5-methyl-2-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile.
| Compound Name | 5-methyl-2-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 107931259 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 5-methyl-2-(1H-1,2,4-triazol-5-ylmethylamino)benzonitrile |
| SMILES | Cc1ccc(NCc2ncn[nH]2)c(C#N)c1 |
| InChI | InChI=1S/C11H11N5/c1-8-2-3-10(9(4-8)5-12)13-6-11-14-7-15-16-11/h2-4,7,13H,6H2,1H3,(H,14,15,16) |
| InChIKey | VVWRXMUEBPXNKW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |