C12H13FN2S — CID 107931868
1-[2-(2-fluoro-5-methylphenyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 107931868) has the molecular formula C12H13FN2S and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-[2-(2-fluoro-5-methylphenyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 1-[2-(2-fluoro-5-methylphenyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 107931868 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-[2-(2-fluoro-5-methylphenyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | Cc1ccc(F)c(-c2ncc(C(C)N)s2)c1 |
| InChI | InChI=1S/C12H13FN2S/c1-7-3-4-10(13)9(5-7)12-15-6-11(16-12)8(2)14/h3-6,8H,14H2,1-2H3 |
| InChIKey | LNACIOZCNAZDJH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |