C11H8FNO2S — CID 107931351
2-(2-fluoro-5-methylphenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 107931351) has the molecular formula C11H8FNO2S and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(2-fluoro-5-methylphenyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(2-fluoro-5-methylphenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107931351 |
| Molecular Formula | C11H8FNO2S |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-(2-fluoro-5-methylphenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1ccc(F)c(-c2ncc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C11H8FNO2S/c1-6-2-3-8(12)7(4-6)10-13-5-9(16-10)11(14)15/h2-5H,1H3,(H,14,15) |
| InChIKey | UZPAUPAGULYCTG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |