C10H7F2N3OS — CID 133061134
2-(2,4-difluorophenyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 133061134) has the molecular formula C10H7F2N3OS and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(2,4-difluorophenyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 133061134 |
| Molecular Formula | C10H7F2N3OS |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | NNC(=O)c1cnc(-c2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C10H7F2N3OS/c11-5-1-2-6(7(12)3-5)10-14-4-8(17-10)9(16)15-13/h1-4H,13H2,(H,15,16) |
| InChIKey | VSERBGZCIIEMRW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|