C11H9F3N2S — CID 107935513
[4-methyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 107935513) has the molecular formula C11H9F3N2S and a molecular weight of 258.27 g/mol. Its IUPAC name is [4-methyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]methanamine.
| Compound Name | [4-methyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 107935513 |
| Molecular Formula | C11H9F3N2S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | [4-methyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | Cc1nc(-c2ccc(F)c(F)c2F)sc1CN |
| InChI | InChI=1S/C11H9F3N2S/c1-5-8(4-15)17-11(16-5)6-2-3-7(12)10(14)9(6)13/h2-3H,4,15H2,1H3 |
| InChIKey | SVYRBURTRNYCRN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|