C10H7F3N2S — CID 107935845
5-methyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-4-amine (PubChem CID 107935845) has the molecular formula C10H7F3N2S and a molecular weight of 244.24 g/mol. Its IUPAC name is 5-methyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-4-amine.
| Compound Name | 5-methyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 107935845 |
| Molecular Formula | C10H7F3N2S |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 5-methyl-2-(2,3,4-trifluorophenyl)-1,3-thiazol-4-amine |
| SMILES | Cc1sc(-c2ccc(F)c(F)c2F)nc1N |
| InChI | InChI=1S/C10H7F3N2S/c1-4-9(14)15-10(16-4)5-2-3-6(11)8(13)7(5)12/h2-3H,14H2,1H3 |
| InChIKey | IWNPWFGXBZWQMW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|