C16H24N2O2 — CID 107937221
1-[5-(methylamino)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-propoxyethanone (PubChem CID 107937221) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[5-(methylamino)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-propoxyethanone.
| Compound Name | 1-[5-(methylamino)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-propoxyethanone |
|---|---|
| PubChem CID | 107937221 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-[5-(methylamino)-2,3,4,5-tetrahydro-1-benzazepin-1-yl]-2-propoxyethanone |
| SMILES | CCCOCC(=O)N1CCCC(NC)c2ccccc21 |
| InChI | InChI=1S/C16H24N2O2/c1-3-11-20-12-16(19)18-10-6-8-14(17-2)13-7-4-5-9-15(13)18/h4-5,7,9,14,17H,3,6,8,10-12H2,1-2H3 |
| InChIKey | KMIWCHMWRGEQFC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|