C14H18Br2N2O — CID 107939910
2,4-dibromo-N-ethyl-N-piperidin-3-ylbenzamide (PubChem CID 107939910) has the molecular formula C14H18Br2N2O and a molecular weight of 390.12 g/mol. Its IUPAC name is 2,4-dibromo-N-ethyl-N-piperidin-3-ylbenzamide.
| Compound Name | 2,4-dibromo-N-ethyl-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 107939910 |
| Molecular Formula | C14H18Br2N2O |
| Molecular Weight | 390.12 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | 2,4-dibromo-N-ethyl-N-piperidin-3-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(Br)cc1Br)C1CCCNC1 |
| InChI | InChI=1S/C14H18Br2N2O/c1-2-18(11-4-3-7-17-9-11)14(19)12-6-5-10(15)8-13(12)16/h5-6,8,11,17H,2-4,7,9H2,1H3 |
| InChIKey | DOIFTDGDPKGJIG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |