C14H18BrClN2O — CID 107990350
2-bromo-4-chloro-N-ethyl-N-piperidin-3-ylbenzamide (PubChem CID 107990350) has the molecular formula C14H18BrClN2O and a molecular weight of 345.67 g/mol. Its IUPAC name is 2-bromo-4-chloro-N-ethyl-N-piperidin-3-ylbenzamide.
| Compound Name | 2-bromo-4-chloro-N-ethyl-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 107990350 |
| Molecular Formula | C14H18BrClN2O |
| Molecular Weight | 345.67 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 2-bromo-4-chloro-N-ethyl-N-piperidin-3-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(Cl)cc1Br)C1CCCNC1 |
| InChI | InChI=1S/C14H18BrClN2O/c1-2-18(11-4-3-7-17-9-11)14(19)12-6-5-10(16)8-13(12)15/h5-6,8,11,17H,2-4,7,9H2,1H3 |
| InChIKey | OGSBUJDYQDPMLO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.67 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |