C12H17ClN2OS — CID 80641610
3-chloro-N-ethyl-N-piperidin-3-ylthiophene-2-carboxamide (PubChem CID 80641610) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is 3-chloro-N-ethyl-N-piperidin-3-ylthiophene-2-carboxamide.
| Compound Name | 3-chloro-N-ethyl-N-piperidin-3-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 80641610 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-chloro-N-ethyl-N-piperidin-3-ylthiophene-2-carboxamide |
| SMILES | CCN(C(=O)c1sccc1Cl)C1CCCNC1 |
| InChI | InChI=1S/C12H17ClN2OS/c1-2-15(9-4-3-6-14-8-9)12(16)11-10(13)5-7-17-11/h5,7,9,14H,2-4,6,8H2,1H3 |
| InChIKey | GJHGQISGUDXVRQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |